C41H40BrO4P — CID 146077793
6-[4-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]phenoxy]hexyl-triphenylphosphanium bromide (PubChem CID 146077793) has the molecular formula C41H40BrO4P and a molecular weight of 707.64 g/mol. Its IUPAC name is 6-[4-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]phenoxy]hexyl-triphenylphosphanium bromide.
| Compound Name | 6-[4-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]phenoxy]hexyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 146077793 |
| Molecular Formula | C41H40BrO4P |
| Molecular Weight | 707.64 g/mol |
| Exact Mass | 706.18 |
| IUPAC Name | 6-[4-[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxoprop-1-enyl]phenoxy]hexyl-triphenylphosphanium bromide |
| SMILES | O=C(/C=C\c1ccc(OCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1ccc2c(c1)OCCO2.[Br-] |
| InChI | InChI=1S/C41H40O4P.BrH/c42-39(34-23-27-40-41(32-34)45-30-29-44-40)26-22-33-20-24-35(25-21-33)43-28-12-1-2-13-31-46(36-14-6-3-7-15-36,37-16-8-4-9-17-37)38-18-10-5-11-19-38;/h3-11,14-27,32H,1-2,12-13,28-31H2;1H/q+1;/p-1/b26-22-; |
| InChIKey | HRUJEGSNVOTDCW-ZRZFDMQESA-M |
| XLogP | 5.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|