C40H38IO5P — CID 44589591
4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide (PubChem CID 44589591) has the molecular formula C40H38IO5P and a molecular weight of 756.62 g/mol. Its IUPAC name is 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide.
| Compound Name | 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 44589591 |
| Molecular Formula | C40H38IO5P |
| Molecular Weight | 756.62 g/mol |
| Exact Mass | 756.15 |
| IUPAC Name | 4-[4-[(E)-2-(3,5-diacetyloxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide |
| SMILES | CC(=O)Oc1cc(/C=C/c2ccc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)cc(OC(C)=O)c1.[I-] |
| InChI | InChI=1S/C40H38O5P.HI/c1-31(41)44-36-28-34(29-37(30-36)45-32(2)42)21-20-33-22-24-35(25-23-33)43-26-12-13-27-46(38-14-6-3-7-15-38,39-16-8-4-9-17-39)40-18-10-5-11-19-40;/h3-11,14-25,28-30H,12-13,26-27H2,1-2H3;1H/q+1;/p-1/b21-20+; |
| InChIKey | UNZILPZQNXKHKH-ANVLNOONSA-M |
| XLogP | 4.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|