C46H46BrO5P — CID 71462884
10-[4-(3-acetyloxy-1,4-dioxonaphthalen-2-yl)phenoxy]decyl-triphenylphosphanium bromide (PubChem CID 71462884) has the molecular formula C46H46BrO5P and a molecular weight of 789.75 g/mol. Its IUPAC name is 10-[4-(3-acetyloxy-1,4-dioxonaphthalen-2-yl)phenoxy]decyl-triphenylphosphanium bromide.
| Compound Name | 10-[4-(3-acetyloxy-1,4-dioxonaphthalen-2-yl)phenoxy]decyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 71462884 |
| Molecular Formula | C46H46BrO5P |
| Molecular Weight | 789.75 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | 10-[4-(3-acetyloxy-1,4-dioxonaphthalen-2-yl)phenoxy]decyl-triphenylphosphanium bromide |
| SMILES | CC(=O)OC1=C(c2ccc(OCCCCCCCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)C(=O)c2ccccc2C1=O.[Br-] |
| InChI | InChI=1S/C46H46O5P.BrH/c1-35(47)51-46-43(44(48)41-27-17-18-28-42(41)45(46)49)36-29-31-37(32-30-36)50-33-19-6-4-2-3-5-7-20-34-52(38-21-11-8-12-22-38,39-23-13-9-14-24-39)40-25-15-10-16-26-40;/h8-18,21-32H,2-7,19-20,33-34H2,1H3;1H/q+1;/p-1 |
| InChIKey | RIUCKQHULYQWCJ-UHFFFAOYSA-M |
| XLogP | 6.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.75 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|