C41H38O3P+ — CID 71450347
6-(3-benzyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium (PubChem CID 71450347) has the molecular formula C41H38O3P+ and a molecular weight of 609.73 g/mol. Its IUPAC name is 6-(3-benzyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium.
| Compound Name | 6-(3-benzyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium |
|---|---|
| PubChem CID | 71450347 |
| Molecular Formula | C41H38O3P+ |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | 6-(3-benzyl-1,4-dioxonaphthalen-2-yl)oxyhexyl-triphenylphosphanium |
| SMILES | O=C1C(Cc2ccccc2)=C(OCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C41H38O3P/c42-39-36-27-15-16-28-37(36)40(43)41(38(39)31-32-19-7-3-8-20-32)44-29-17-1-2-18-30-45(33-21-9-4-10-22-33,34-23-11-5-12-24-34)35-25-13-6-14-26-35/h3-16,19-28H,1-2,17-18,29-31H2/q+1 |
| InChIKey | WBMMVRGIJGTNFU-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|