C23H23BrO3 — CID 89429003
2-benzyl-3-(6-bromohexoxy)naphthalene-1,4-dione (PubChem CID 89429003) has the molecular formula C23H23BrO3 and a molecular weight of 427.34 g/mol. Its IUPAC name is 2-benzyl-3-(6-bromohexoxy)naphthalene-1,4-dione.
| Compound Name | 2-benzyl-3-(6-bromohexoxy)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 89429003 |
| Molecular Formula | C23H23BrO3 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-benzyl-3-(6-bromohexoxy)naphthalene-1,4-dione |
| SMILES | O=C1C(Cc2ccccc2)=C(OCCCCCCBr)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H23BrO3/c24-14-8-1-2-9-15-27-23-20(16-17-10-4-3-5-11-17)21(25)18-12-6-7-13-19(18)22(23)26/h3-7,10-13H,1-2,8-9,14-16H2 |
| InChIKey | SIZXGMUBNYGDTQ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|