C35H28O3P+ — CID 59248407
3-(9,10-dioxoanthracen-2-yl)oxypropyl-triphenylphosphanium (PubChem CID 59248407) has the molecular formula C35H28O3P+ and a molecular weight of 527.58 g/mol. Its IUPAC name is 3-(9,10-dioxoanthracen-2-yl)oxypropyl-triphenylphosphanium.
| Compound Name | 3-(9,10-dioxoanthracen-2-yl)oxypropyl-triphenylphosphanium |
|---|---|
| PubChem CID | 59248407 |
| Molecular Formula | C35H28O3P+ |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 3-(9,10-dioxoanthracen-2-yl)oxypropyl-triphenylphosphanium |
| SMILES | O=C1c2ccccc2C(=O)c2cc(OCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)ccc21 |
| InChI | InChI=1S/C35H28O3P/c36-34-30-19-10-11-20-31(30)35(37)33-25-26(21-22-32(33)34)38-23-12-24-39(27-13-4-1-5-14-27,28-15-6-2-7-16-28)29-17-8-3-9-18-29/h1-11,13-22,25H,12,23-24H2/q+1 |
| InChIKey | TXJSREOGKHYLIU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|