C29H31NO2P+ — CID 155013002
4-[4-(aminomethyl)-3-hydroxyphenoxy]butyl-triphenylphosphanium (PubChem CID 155013002) has the molecular formula C29H31NO2P+ and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-3-hydroxyphenoxy]butyl-triphenylphosphanium.
| Compound Name | 4-[4-(aminomethyl)-3-hydroxyphenoxy]butyl-triphenylphosphanium |
|---|---|
| PubChem CID | 155013002 |
| Molecular Formula | C29H31NO2P+ |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-[4-(aminomethyl)-3-hydroxyphenoxy]butyl-triphenylphosphanium |
| SMILES | NCc1ccc(OCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1O |
| InChI | InChI=1S/C29H30NO2P/c30-23-24-18-19-25(22-29(24)31)32-20-10-11-21-33(26-12-4-1-5-13-26,27-14-6-2-7-15-27)28-16-8-3-9-17-28/h1-9,12-19,22H,10-11,20-21,23,30H2/p+1 |
| InChIKey | APRSSJNWOMPIPH-UHFFFAOYSA-O |
| XLogP | 5.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|