C36H34IO3P — CID 171355772
4-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide (PubChem CID 171355772) has the molecular formula C36H34IO3P and a molecular weight of 672.54 g/mol. Its IUPAC name is 4-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide.
| Compound Name | 4-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 171355772 |
| Molecular Formula | C36H34IO3P |
| Molecular Weight | 672.54 g/mol |
| Exact Mass | 672.13 |
| IUPAC Name | 4-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]butyl-triphenylphosphanium iodide |
| SMILES | Oc1ccc(/C=C/c2cc(O)cc(OCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c2)cc1.[I-] |
| InChI | InChI=1S/C36H33O3P.HI/c37-31-22-20-29(21-23-31)18-19-30-26-32(38)28-33(27-30)39-24-10-11-25-40(34-12-4-1-5-13-34,35-14-6-2-7-15-35)36-16-8-3-9-17-36;/h1-9,12-23,26-28H,10-11,24-25H2,(H-,37,38);1H/b19-18+; |
| InChIKey | OLDUENZVABIZJD-LTRPLHCISA-N |
| XLogP | 4.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|