C17H18O3 — CID 57478513
3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-propoxyphenol (PubChem CID 57478513) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-propoxyphenol.
| Compound Name | 3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-propoxyphenol |
|---|---|
| PubChem CID | 57478513 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-propoxyphenol |
| SMILES | CCCOc1cc(O)cc(/C=C/c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H18O3/c1-2-9-20-17-11-14(10-16(19)12-17)4-3-13-5-7-15(18)8-6-13/h3-8,10-12,18-19H,2,9H2,1H3/b4-3+ |
| InChIKey | QRLRLYWXFZKFCW-ONEGZZNKSA-N |
| XLogP | 4.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|