About O-silyl resveratrol
O-silyl resveratrol (PubChem CID 171364243) has the molecular formula C14H11O3Si
and a molecular weight of 255.33 g/mol.
Molecular Properties
| Compound Name | O-silyl resveratrol |
| PubChem CID | 171364243 |
| Molecular Formula | C14H11O3Si |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | — |
| SMILES | Oc1ccc(C=Cc2cc(O)cc(O[Si])c2)cc1 |
| InChI | InChI=1S/C14H11O3Si/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(8-11)17-18/h1-9,15-16H |
| InChIKey | SQMAMKMJVPVWNN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze O-silyl resveratrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-silyl resveratrol?
The IUPAC name of O-silyl resveratrol (CID 171364243) is not available.
What is the SMILES notation for O-silyl resveratrol?
The canonical SMILES for O-silyl resveratrol is Oc1ccc(C=Cc2cc(O)cc(O[Si])c2)cc1.
What is the InChIKey of O-silyl resveratrol?
The InChIKey is SQMAMKMJVPVWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11O3Si/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(8-11)17-18/h1-9,15-16H.
What are the key properties of O-silyl resveratrol?
O-silyl resveratrol has a molecular weight of 255.33 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-silyl resveratrol is sourced from PubChem (CID 171364243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).