About 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium
4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium (PubChem CID 157160802) has the molecular formula C22H18I3O2V
and a molecular weight of 746.04 g/mol. Its IUPAC name is 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium.
Molecular Properties
| Compound Name | 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium |
| PubChem CID | 157160802 |
| Molecular Formula | C22H18I3O2V |
| Molecular Weight | 746.04 g/mol |
| Exact Mass | 745.79 |
| IUPAC Name | 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium |
| SMILES | I[V](I)I.Oc1ccc(/C=C/c2ccc(/C=C/c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18O2.3HI.V/c23-21-13-9-19(10-14-21)7-5-17-1-2-18(4-3-17)6-8-20-11-15-22(24)16-12-20;;;;/h1-16,23-24H;3*1H;/q;;;;+3/p-3/b7-5+,8-6+;;;; |
| InChIKey | AMISVUBJSZBZGS-IVVFPIAUSA-K |
| XLogP | 8.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.04 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium?
The IUPAC name of 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium (CID 157160802) is 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium.
What is the SMILES notation for 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium?
The canonical SMILES for 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium is I[V](I)I.Oc1ccc(/C=C/c2ccc(/C=C/c3ccc(O)cc3)cc2)cc1.
What is the InChIKey of 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium?
The InChIKey is AMISVUBJSZBZGS-IVVFPIAUSA-K. The full InChI is InChI=1S/C22H18O2.3HI.V/c23-21-13-9-19(10-14-21)7-5-17-1-2-18(4-3-17)6-8-20-11-15-22(24)16-12-20;;;;/h1-16,23-24H;3*1H;/q;;;;+3/p-3/b7-5+,8-6+;;;;.
What are the key properties of 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium?
4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium has a molecular weight of 746.04 g/mol, XLogP of 8.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[4-[(E)-2-(4-hydroxyphenyl)ethenyl]phenyl]ethenyl]phenol;triiodovanadium is sourced from PubChem (CID 157160802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).