[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid

C15H15BO2 — CID 160843028

IUPAC[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid
SMILESCB(O)c1ccc(C=Cc2ccc(O)cc2)cc1
InChIInChI=1S/C15H15BO2/c1-16(18)14-8-4-12(5-9-14)2-3-13-6-10-15(17)11-7-13/h2-11,17-18H,1H3
InChIKeyCUQAXQYNPZUBHY-UHFFFAOYSA-N
MW238.09 g/mol
LogP2.38
Rot. Bonds3

About [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid

[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid (PubChem CID 160843028) has the molecular formula C15H15BO2 and a molecular weight of 238.09 g/mol. Its IUPAC name is [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid.

Molecular Properties

Compound Name[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid
PubChem CID160843028
Molecular FormulaC15H15BO2
Molecular Weight238.09 g/mol
Exact Mass238.12
IUPAC Name[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid
SMILESCB(O)c1ccc(C=Cc2ccc(O)cc2)cc1
InChIInChI=1S/C15H15BO2/c1-16(18)14-8-4-12(5-9-14)2-3-13-6-10-15(17)11-7-13/h2-11,17-18H,1H3
InChIKeyCUQAXQYNPZUBHY-UHFFFAOYSA-N
XLogP2.38
TPSA40.46 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.09
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid?
The IUPAC name of [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid (CID 160843028) is [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid.
What is the SMILES notation for [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid?
The canonical SMILES for [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid is CB(O)c1ccc(C=Cc2ccc(O)cc2)cc1.
What is the InChIKey of [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid?
The InChIKey is CUQAXQYNPZUBHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BO2/c1-16(18)14-8-4-12(5-9-14)2-3-13-6-10-15(17)11-7-13/h2-11,17-18H,1H3.
What are the key properties of [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid?
[4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid has a molecular weight of 238.09 g/mol, XLogP of 2.38, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-hydroxyphenyl)ethenyl]phenyl]-methylborinic acid is sourced from PubChem (CID 160843028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).