C15H16O3 — CID 74438837
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;methane (PubChem CID 74438837) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;methane.
| Compound Name | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;methane |
|---|---|
| PubChem CID | 74438837 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol;methane |
| SMILES | C.Oc1ccc(C=Cc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C14H12O3.CH4/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11;/h1-9,15-17H;1H4 |
| InChIKey | FUNISYCYCUZNLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|