C15H14O2S — CID 87118922
5-[(E)-2-[4-(sulfanylmethyl)phenyl]ethenyl]benzene-1,3-diol (PubChem CID 87118922) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 5-[(E)-2-[4-(sulfanylmethyl)phenyl]ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-[4-(sulfanylmethyl)phenyl]ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 87118922 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-[(E)-2-[4-(sulfanylmethyl)phenyl]ethenyl]benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(CS)cc2)c1 |
| InChI | InChI=1S/C15H14O2S/c16-14-7-13(8-15(17)9-14)6-3-11-1-4-12(10-18)5-2-11/h1-9,16-18H,10H2/b6-3+ |
| InChIKey | NYZHHVNEUUGATE-ZZXKWVIFSA-N |
| XLogP | 3.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|