C18H20O2 — CID 71454329
5-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene-1,3-diol (PubChem CID 71454329) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 71454329 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-[(E)-2-(4-tert-butylphenyl)ethenyl]benzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-18(2,3)15-8-6-13(7-9-15)4-5-14-10-16(19)12-17(20)11-14/h4-12,19-20H,1-3H3/b5-4+ |
| InChIKey | NZKIRBYNYIFAFD-SNAWJCMRSA-N |
| XLogP | 4.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|