C18H20O3 — CID 162699386
5-[(E)-2-(4-tert-butyl-3-hydroxyphenyl)ethenyl]benzene-1,3-diol (PubChem CID 162699386) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-[(E)-2-(4-tert-butyl-3-hydroxyphenyl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(4-tert-butyl-3-hydroxyphenyl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 162699386 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-[(E)-2-(4-tert-butyl-3-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc(/C=C/c2cc(O)cc(O)c2)cc1O |
| InChI | InChI=1S/C18H20O3/c1-18(2,3)16-7-6-12(10-17(16)21)4-5-13-8-14(19)11-15(20)9-13/h4-11,19-21H,1-3H3/b5-4+ |
| InChIKey | PFPRZOYBEKYETJ-SNAWJCMRSA-N |
| XLogP | 4.27 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|