C14H12O5 — CID 143585008
5-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]benzene-1,2,3-triol (PubChem CID 143585008) has the molecular formula C14H12O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is 5-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]benzene-1,2,3-triol.
| Compound Name | 5-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 143585008 |
| Molecular Formula | C14H12O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-[(Z)-2-(3,4-dihydroxyphenyl)ethenyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(/C=C\c2cc(O)c(O)c(O)c2)cc1O |
| InChI | InChI=1S/C14H12O5/c15-10-4-3-8(5-11(10)16)1-2-9-6-12(17)14(19)13(18)7-9/h1-7,15-19H/b2-1- |
| InChIKey | NHDCJIRSEKZXEL-UPHRSURJSA-N |
| XLogP | 2.38 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|