C9H7F3O2 — CID 102235179
4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene-1,2-diol (PubChem CID 102235179) has the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. Its IUPAC name is 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 102235179 |
| Molecular Formula | C9H7F3O2 |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-[(E)-3,3,3-trifluoroprop-1-enyl]benzene-1,2-diol |
| SMILES | Oc1ccc(/C=C/C(F)(F)F)cc1O |
| InChI | InChI=1S/C9H7F3O2/c10-9(11,12)4-3-6-1-2-7(13)8(14)5-6/h1-5,13-14H/b4-3+ |
| InChIKey | YKHOQSAKXPSDAJ-ONEGZZNKSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|