C12H8F6 — CID 162618541
1,4-bis(3,3,3-trifluoroprop-1-enyl)benzene (PubChem CID 162618541) has the molecular formula C12H8F6 and a molecular weight of 266.18 g/mol. Its IUPAC name is 1,4-bis(3,3,3-trifluoroprop-1-enyl)benzene.
| Compound Name | 1,4-bis(3,3,3-trifluoroprop-1-enyl)benzene |
|---|---|
| PubChem CID | 162618541 |
| Molecular Formula | C12H8F6 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1,4-bis(3,3,3-trifluoroprop-1-enyl)benzene |
| SMILES | FC(F)(F)C=Cc1ccc(C=CC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F6/c13-11(14,15)7-5-9-1-2-10(4-3-9)6-8-12(16,17)18/h1-8H |
| InChIKey | IWGPEUZKRDKADE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |