About 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene
5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene (PubChem CID 139578347) has the molecular formula C11H7F3S
and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene.
Molecular Properties
| Compound Name | 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene |
| PubChem CID | 139578347 |
| Molecular Formula | C11H7F3S |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene |
| SMILES | FC(F)(F)C=Cc1ccc2sccc2c1 |
| InChI | InChI=1S/C11H7F3S/c12-11(13,14)5-3-8-1-2-10-9(7-8)4-6-15-10/h1-7H |
| InChIKey | SRLGBDWIYYZBOB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene?
The IUPAC name of 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene (CID 139578347) is 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene.
What is the SMILES notation for 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene?
The canonical SMILES for 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene is FC(F)(F)C=Cc1ccc2sccc2c1.
What is the InChIKey of 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene?
The InChIKey is SRLGBDWIYYZBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3S/c12-11(13,14)5-3-8-1-2-10-9(7-8)4-6-15-10/h1-7H.
What are the key properties of 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene?
5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene has a molecular weight of 228.24 g/mol, XLogP of 4.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3,3-trifluoroprop-1-enyl)-1-benzothiophene is sourced from PubChem (CID 139578347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).