C19H22BNO2S — CID 146168279
(E,2S)-4-(1-benzothiophen-5-yl)-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]but-3-enenitrile (PubChem CID 146168279) has the molecular formula C19H22BNO2S and a molecular weight of 339.27 g/mol. Its IUPAC name is (E,2S)-4-(1-benzothiophen-5-yl)-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]but-3-enenitrile.
| Compound Name | (E,2S)-4-(1-benzothiophen-5-yl)-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]but-3-enenitrile |
|---|---|
| PubChem CID | 146168279 |
| Molecular Formula | C19H22BNO2S |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (E,2S)-4-(1-benzothiophen-5-yl)-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]but-3-enenitrile |
| SMILES | CC1(C)OB(C[C@H](C#N)/C=C/c2ccc3sccc3c2)OC1(C)C |
| InChI | InChI=1S/C19H22BNO2S/c1-18(2)19(3,4)23-20(22-18)12-15(13-21)6-5-14-7-8-17-16(11-14)9-10-24-17/h5-11,15H,12H2,1-4H3/b6-5+/t15-/m1/s1 |
| InChIKey | BVTNTARGWDAFOO-LLYBFZRZSA-N |
| XLogP | 5.15 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|