C22H21BO3S2 — CID 174062528
2-[[2-(1-benzothiophen-5-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-1-benzothiophen-5-ol (PubChem CID 174062528) has the molecular formula C22H21BO3S2 and a molecular weight of 408.35 g/mol. Its IUPAC name is 2-[[2-(1-benzothiophen-5-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-1-benzothiophen-5-ol.
| Compound Name | 2-[[2-(1-benzothiophen-5-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-1-benzothiophen-5-ol |
|---|---|
| PubChem CID | 174062528 |
| Molecular Formula | C22H21BO3S2 |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[[2-(1-benzothiophen-5-yl)-4,5,5-trimethyl-1,3,2-dioxaborolan-4-yl]methyl]-1-benzothiophen-5-ol |
| SMILES | CC1(C)OB(c2ccc3sccc3c2)OC1(C)Cc1cc2cc(O)ccc2s1 |
| InChI | InChI=1S/C22H21BO3S2/c1-21(2)22(3,13-18-12-15-11-17(24)5-7-20(15)28-18)26-23(25-21)16-4-6-19-14(10-16)8-9-27-19/h4-12,24H,13H2,1-3H3 |
| InChIKey | BJIINVARFBOETC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|