C15H19BO2S — CID 150289104
2-(1-benzothiophen-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane (PubChem CID 150289104) has the molecular formula C15H19BO2S and a molecular weight of 274.19 g/mol. Its IUPAC name is 2-(1-benzothiophen-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(1-benzothiophen-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 150289104 |
| Molecular Formula | C15H19BO2S |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(1-benzothiophen-6-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(c2ccc3ccsc3c2)OC1(C)C |
| InChI | InChI=1S/C15H19BO2S/c1-14(2)10-17-16(18-15(14,3)4)12-6-5-11-7-8-19-13(11)9-12/h5-9H,10H2,1-4H3 |
| InChIKey | GHEZEUKEVXJPID-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|