C22H24BNO2 — CID 150038387
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]isoquinoline (PubChem CID 150038387) has the molecular formula C22H24BNO2 and a molecular weight of 345.25 g/mol. Its IUPAC name is 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]isoquinoline.
| Compound Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 150038387 |
| Molecular Formula | C22H24BNO2 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]isoquinoline |
| SMILES | CC1(C)COB(c2ccc(-c3nccc4ccccc34)cc2)OC1(C)C |
| InChI | InChI=1S/C22H24BNO2/c1-21(2)15-25-23(26-22(21,3)4)18-11-9-17(10-12-18)20-19-8-6-5-7-16(19)13-14-24-20/h5-14H,15H2,1-4H3 |
| InChIKey | DITFVZCQHYELIW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|