C29H34BNO2 — CID 174759521
3,6-diethyl-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]carbazole (PubChem CID 174759521) has the molecular formula C29H34BNO2 and a molecular weight of 439.41 g/mol. Its IUPAC name is 3,6-diethyl-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]carbazole.
| Compound Name | 3,6-diethyl-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 174759521 |
| Molecular Formula | C29H34BNO2 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3,6-diethyl-9-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)phenyl]carbazole |
| SMILES | CCc1ccc2c(c1)c1cc(CC)ccc1n2-c1ccc(B2OCC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C29H34BNO2/c1-7-20-9-15-26-24(17-20)25-18-21(8-2)10-16-27(25)31(26)23-13-11-22(12-14-23)30-32-19-28(3,4)29(5,6)33-30/h9-18H,7-8,19H2,1-6H3 |
| InChIKey | ABUYBOWYVFYHKF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|