C16H21BO3 — CID 151501634
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2,3-dihydroinden-1-one (PubChem CID 151501634) has the molecular formula C16H21BO3 and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2,3-dihydroinden-1-one.
| Compound Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 151501634 |
| Molecular Formula | C16H21BO3 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborinan-2-yl)-2,3-dihydroinden-1-one |
| SMILES | CC1(C)COB(c2ccc3c(c2)CCC3=O)OC1(C)C |
| InChI | InChI=1S/C16H21BO3/c1-15(2)10-19-17(20-16(15,3)4)12-6-7-13-11(9-12)5-8-14(13)18/h6-7,9H,5,8,10H2,1-4H3 |
| InChIKey | PQNZGUDIQZFRKS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|