C19H20B2O2 — CID 163431585
CID 163431585 (PubChem CID 163431585) has the molecular formula C19H20B2O2 and a molecular weight of 301.99 g/mol.
| Compound Name | CID 163431585 |
|---|---|
| PubChem CID | 163431585 |
| Molecular Formula | C19H20B2O2 |
| Molecular Weight | 301.99 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)Cc1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C19H20B2O2/c1-18(2)19(3,4)23-21(22-18)15-6-8-17-13(11-15)9-12-10-14(20)5-7-16(12)17/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | FALHNLLKXASYME-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.99 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|