C29H36B2O2 — CID 142315314
CID 142315314 (PubChem CID 142315314) has the molecular formula C29H36B2O2 and a molecular weight of 438.23 g/mol.
| Compound Name | CID 142315314 |
|---|---|
| PubChem CID | 142315314 |
| Molecular Formula | C29H36B2O2 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(CCCC=C)(CCCC=C)c1cc(B3OC(C)(C)C(C)(C)O3)ccc1-2 |
| InChI | InChI=1S/C29H36B2O2/c1-7-9-11-17-29(18-12-10-8-2)25-19-21(30)13-15-23(25)24-16-14-22(20-26(24)29)31-32-27(3,4)28(5,6)33-31/h7-8,13-16,19-20H,1-2,9-12,17-18H2,3-6H3 |
| InChIKey | WZMRPWWQNRRMFY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|