C41H60B2O8 — CID 171591073
ethyl 6-[9-(6-ethoxy-6-oxohexyl)-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]hexanoate (PubChem CID 171591073) has the molecular formula C41H60B2O8 and a molecular weight of 702.55 g/mol. Its IUPAC name is ethyl 6-[9-(6-ethoxy-6-oxohexyl)-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]hexanoate.
| Compound Name | ethyl 6-[9-(6-ethoxy-6-oxohexyl)-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]hexanoate |
|---|---|
| PubChem CID | 171591073 |
| Molecular Formula | C41H60B2O8 |
| Molecular Weight | 702.55 g/mol |
| Exact Mass | 702.45 |
| IUPAC Name | ethyl 6-[9-(6-ethoxy-6-oxohexyl)-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-9-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCC1(CCCCCC(=O)OCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C41H60B2O8/c1-11-46-35(44)19-15-13-17-25-41(26-18-14-16-20-36(45)47-12-2)33-27-29(42-48-37(3,4)38(5,6)49-42)21-23-31(33)32-24-22-30(28-34(32)41)43-50-39(7,8)40(9,10)51-43/h21-24,27-28H,11-20,25-26H2,1-10H3 |
| InChIKey | GSDVDFPTIQXJKL-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.55 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|