C39H55BO2S — CID 11556185
2-(9,9-dioctyl-7-thiophen-2-ylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11556185) has the molecular formula C39H55BO2S and a molecular weight of 598.75 g/mol. Its IUPAC name is 2-(9,9-dioctyl-7-thiophen-2-ylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(9,9-dioctyl-7-thiophen-2-ylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11556185 |
| Molecular Formula | C39H55BO2S |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.40 |
| IUPAC Name | 2-(9,9-dioctyl-7-thiophen-2-ylfluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(-c3cccs3)cc21 |
| InChI | InChI=1S/C39H55BO2S/c1-7-9-11-13-15-17-25-39(26-18-16-14-12-10-8-2)34-28-30(36-20-19-27-43-36)21-23-32(34)33-24-22-31(29-35(33)39)40-41-37(3,4)38(5,6)42-40/h19-24,27-29H,7-18,25-26H2,1-6H3 |
| InChIKey | KCJQCNRXERXIGE-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|