C42H60BNO2 — CID 156828225
2-(7-ethyl-9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 156828225) has the molecular formula C42H60BNO2 and a molecular weight of 621.76 g/mol. Its IUPAC name is 2-(7-ethyl-9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(7-ethyl-9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 156828225 |
| Molecular Formula | C42H60BNO2 |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 621.47 |
| IUPAC Name | 2-(7-ethyl-9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(CC)ccc2-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cn3)cc21 |
| InChI | InChI=1S/C42H60BNO2/c1-8-11-13-15-17-19-27-42(28-20-18-16-14-12-9-2)37-29-32(10-3)21-24-35(37)36-25-22-33(30-38(36)42)39-26-23-34(31-44-39)43-45-40(4,5)41(6,7)46-43/h21-26,29-31H,8-20,27-28H2,1-7H3 |
| InChIKey | GPOWEHGUSFWDTL-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|