C40H56BNO2 — CID 140941455
2-(9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140941455) has the molecular formula C40H56BNO2 and a molecular weight of 593.71 g/mol. Its IUPAC name is 2-(9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140941455 |
| Molecular Formula | C40H56BNO2 |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.44 |
| IUPAC Name | 2-(9,9-dioctylfluoren-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cn3)cc21 |
| InChI | InChI=1S/C40H56BNO2/c1-7-9-11-13-15-19-27-40(28-20-16-14-12-10-8-2)35-22-18-17-21-33(35)34-25-23-31(29-36(34)40)37-26-24-32(30-42-37)41-43-38(3,4)39(5,6)44-41/h17-18,21-26,29-30H,7-16,19-20,27-28H2,1-6H3 |
| InChIKey | RTPVKSZZYBRRGT-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|