C41H64B2O4 — CID 141374528
2-[9,9-dioctyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 141374528) has the molecular formula C41H64B2O4 and a molecular weight of 642.58 g/mol. Its IUPAC name is 2-[9,9-dioctyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[9,9-dioctyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 141374528 |
| Molecular Formula | C41H64B2O4 |
| Molecular Weight | 642.58 g/mol |
| Exact Mass | 642.50 |
| IUPAC Name | 2-[9,9-dioctyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(B3OC(C)(C)C(C)(C)O3)c(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C41H64B2O4/c1-11-13-15-17-19-23-29-41(30-24-20-18-16-14-12-2)33-26-22-21-25-31(33)32-27-28-34(42-44-37(3,4)38(5,6)45-42)36(35(32)41)43-46-39(7,8)40(9,10)47-43/h21-22,25-28H,11-20,23-24,29-30H2,1-10H3 |
| InChIKey | MKMQYPQDLJZDOR-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.58 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|