C29H36Br2O4 — CID 122396592
ethyl 6-[2,7-dibromo-9-(6-ethoxy-6-oxohexyl)fluoren-9-yl]hexanoate (PubChem CID 122396592) has the molecular formula C29H36Br2O4 and a molecular weight of 608.41 g/mol. Its IUPAC name is ethyl 6-[2,7-dibromo-9-(6-ethoxy-6-oxohexyl)fluoren-9-yl]hexanoate.
| Compound Name | ethyl 6-[2,7-dibromo-9-(6-ethoxy-6-oxohexyl)fluoren-9-yl]hexanoate |
|---|---|
| PubChem CID | 122396592 |
| Molecular Formula | C29H36Br2O4 |
| Molecular Weight | 608.41 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | ethyl 6-[2,7-dibromo-9-(6-ethoxy-6-oxohexyl)fluoren-9-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCC1(CCCCCC(=O)OCC)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C29H36Br2O4/c1-3-34-27(32)11-7-5-9-17-29(18-10-6-8-12-28(33)35-4-2)25-19-21(30)13-15-23(25)24-16-14-22(31)20-26(24)29/h13-16,19-20H,3-12,17-18H2,1-2H3 |
| InChIKey | IZXLEYLKMNBJOJ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.41 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|