C25H24Br2O4 — CID 86606152
3-[2,7-dibromo-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]propyl prop-2-enoate (PubChem CID 86606152) has the molecular formula C25H24Br2O4 and a molecular weight of 548.27 g/mol. Its IUPAC name is 3-[2,7-dibromo-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]propyl prop-2-enoate.
| Compound Name | 3-[2,7-dibromo-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 86606152 |
| Molecular Formula | C25H24Br2O4 |
| Molecular Weight | 548.27 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | 3-[2,7-dibromo-9-(3-prop-2-enoyloxypropyl)fluoren-9-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC1(CCCOC(=O)C=C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H24Br2O4/c1-3-23(28)30-13-5-11-25(12-6-14-31-24(29)4-2)21-15-17(26)7-9-19(21)20-10-8-18(27)16-22(20)25/h3-4,7-10,15-16H,1-2,5-6,11-14H2 |
| InChIKey | WBRXNKORJLYYTP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.27 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|