C25H34Br2O6P2 — CID 141174107
6-[2,7-dibromo-9-(6-phosphonohexyl)fluoren-9-yl]hexylphosphonic acid (PubChem CID 141174107) has the molecular formula C25H34Br2O6P2 and a molecular weight of 652.30 g/mol. Its IUPAC name is 6-[2,7-dibromo-9-(6-phosphonohexyl)fluoren-9-yl]hexylphosphonic acid.
| Compound Name | 6-[2,7-dibromo-9-(6-phosphonohexyl)fluoren-9-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 141174107 |
| Molecular Formula | C25H34Br2O6P2 |
| Molecular Weight | 652.30 g/mol |
| Exact Mass | 650.02 |
| IUPAC Name | 6-[2,7-dibromo-9-(6-phosphonohexyl)fluoren-9-yl]hexylphosphonic acid |
| SMILES | O=P(O)(O)CCCCCCC1(CCCCCCP(=O)(O)O)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C25H34Br2O6P2/c26-19-9-11-21-22-12-10-20(27)18-24(22)25(23(21)17-19,13-5-1-3-7-15-34(28,29)30)14-6-2-4-8-16-35(31,32)33/h9-12,17-18H,1-8,13-16H2,(H2,28,29,30)(H2,31,32,33) |
| InChIKey | OPRNZBBSKXLMGL-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.30 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|