C31H32O6P2 — CID 102581615
3-[2,7-diphenyl-9-(3-phosphonopropyl)fluoren-9-yl]propylphosphonic acid (PubChem CID 102581615) has the molecular formula C31H32O6P2 and a molecular weight of 562.54 g/mol. Its IUPAC name is 3-[2,7-diphenyl-9-(3-phosphonopropyl)fluoren-9-yl]propylphosphonic acid.
| Compound Name | 3-[2,7-diphenyl-9-(3-phosphonopropyl)fluoren-9-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 102581615 |
| Molecular Formula | C31H32O6P2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | 3-[2,7-diphenyl-9-(3-phosphonopropyl)fluoren-9-yl]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCC1(CCCP(=O)(O)O)c2cc(-c3ccccc3)ccc2-c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C31H32O6P2/c32-38(33,34)19-7-17-31(18-8-20-39(35,36)37)29-21-25(23-9-3-1-4-10-23)13-15-27(29)28-16-14-26(22-30(28)31)24-11-5-2-6-12-24/h1-6,9-16,21-22H,7-8,17-20H2,(H2,32,33,34)(H2,35,36,37) |
| InChIKey | WCONSRUVKBMURV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|