C79H78Br2N2 — CID 175976628
trimethyl-[4-[9-[4-(trimethylazaniumyl)butyl]-2,7-bis[4-(1,2,2-triphenylethenyl)phenyl]fluoren-9-yl]butyl]azanium dibromide (PubChem CID 175976628) has the molecular formula C79H78Br2N2 and a molecular weight of 1215.32 g/mol. Its IUPAC name is trimethyl-[4-[9-[4-(trimethylazaniumyl)butyl]-2,7-bis[4-(1,2,2-triphenylethenyl)phenyl]fluoren-9-yl]butyl]azanium dibromide.
| Compound Name | trimethyl-[4-[9-[4-(trimethylazaniumyl)butyl]-2,7-bis[4-(1,2,2-triphenylethenyl)phenyl]fluoren-9-yl]butyl]azanium dibromide |
|---|---|
| PubChem CID | 175976628 |
| Molecular Formula | C79H78Br2N2 |
| Molecular Weight | 1215.32 g/mol |
| Exact Mass | 1212.45 |
| IUPAC Name | trimethyl-[4-[9-[4-(trimethylazaniumyl)butyl]-2,7-bis[4-(1,2,2-triphenylethenyl)phenyl]fluoren-9-yl]butyl]azanium dibromide |
| SMILES | C[N+](C)(C)CCCCC1(CCCC[N+](C)(C)C)c2cc(-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)ccc2-c2ccc(-c3ccc(C(=C(c4ccccc4)c4ccccc4)c4ccccc4)cc3)cc21.[Br-].[Br-] |
| InChI | InChI=1S/C79H78N2.2BrH/c1-80(2,3)55-27-25-53-79(54-26-28-56-81(4,5)6)73-57-69(59-41-45-67(46-42-59)77(65-37-21-11-22-38-65)75(61-29-13-7-14-30-61)62-31-15-8-16-32-62)49-51-71(73)72-52-50-70(58-74(72)79)60-43-47-68(48-44-60)78(66-39-23-12-24-40-66)76(63-33-17-9-18-34-63)64-35-19-10-20-36-64;;/h7-24,29-52,57-58H,25-28,53-56H2,1-6H3;2*1H/q+2;;/p-2 |
| InChIKey | ACPCUOSCZKTCBC-UHFFFAOYSA-L |
| XLogP | 13.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1215.32 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|