C54H78N2+2 — CID 102467018
3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-(trimethylazaniumyl)propyl]fluoren-9-yl]propyl-trimethylazanium (PubChem CID 102467018) has the molecular formula C54H78N2+2 and a molecular weight of 755.23 g/mol. Its IUPAC name is 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-(trimethylazaniumyl)propyl]fluoren-9-yl]propyl-trimethylazanium.
| Compound Name | 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-(trimethylazaniumyl)propyl]fluoren-9-yl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 102467018 |
| Molecular Formula | C54H78N2+2 |
| Molecular Weight | 755.23 g/mol |
| Exact Mass | 754.62 |
| IUPAC Name | 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-(trimethylazaniumyl)propyl]fluoren-9-yl]propyl-trimethylazanium |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(CCC[N+](C)(C)C)(CCC[N+](C)(C)C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C54H78N2/c1-9-11-13-15-17-23-35-53(36-24-18-16-14-12-10-2)49-29-21-19-27-45(49)47-33-31-43(41-51(47)53)44-32-34-48-46-28-20-22-30-50(46)54(52(48)42-44,37-25-39-55(3,4)5)38-26-40-56(6,7)8/h19-22,27-34,41-42H,9-18,23-26,35-40H2,1-8H3/q+2 |
| InChIKey | FMSFRMZWUWTITH-UHFFFAOYSA-N |
| XLogP | 14.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.23 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|