C56H82N2+2 — CID 101423085
3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-[ethyl(dimethyl)azaniumyl]propyl]fluoren-9-yl]propyl-ethyl-dimethylazanium (PubChem CID 101423085) has the molecular formula C56H82N2+2 and a molecular weight of 783.29 g/mol. Its IUPAC name is 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-[ethyl(dimethyl)azaniumyl]propyl]fluoren-9-yl]propyl-ethyl-dimethylazanium.
| Compound Name | 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-[ethyl(dimethyl)azaniumyl]propyl]fluoren-9-yl]propyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 101423085 |
| Molecular Formula | C56H82N2+2 |
| Molecular Weight | 783.29 g/mol |
| Exact Mass | 782.65 |
| IUPAC Name | 3-[2-(9,9-dioctylfluoren-2-yl)-9-[3-[ethyl(dimethyl)azaniumyl]propyl]fluoren-9-yl]propyl-ethyl-dimethylazanium |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2ccccc2-c2ccc(-c3ccc4c(c3)C(CCC[N+](C)(C)CC)(CCC[N+](C)(C)CC)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C56H82N2/c1-9-13-15-17-19-25-37-55(38-26-20-18-16-14-10-2)51-31-23-21-29-47(51)49-35-33-45(43-53(49)55)46-34-36-50-48-30-22-24-32-52(48)56(54(50)44-46,39-27-41-57(5,6)11-3)40-28-42-58(7,8)12-4/h21-24,29-36,43-44H,9-20,25-28,37-42H2,1-8H3/q+2 |
| InChIKey | XYRLPDJFFAPIFO-UHFFFAOYSA-N |
| XLogP | 15.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.29 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|