C50H65N3O2+2 — CID 123348244
6-[9-[6-[diethyl(hydroxy)azaniumyl]hexyl]-2-phenyl-7-(6-phenyl-3-pyridinyl)fluoren-9-yl]hexyl-diethyl-hydroxyazanium (PubChem CID 123348244) has the molecular formula C50H65N3O2+2 and a molecular weight of 740.09 g/mol. Its IUPAC name is 6-[9-[6-[diethyl(hydroxy)azaniumyl]hexyl]-2-phenyl-7-(6-phenyl-3-pyridinyl)fluoren-9-yl]hexyl-diethyl-hydroxyazanium.
| Compound Name | 6-[9-[6-[diethyl(hydroxy)azaniumyl]hexyl]-2-phenyl-7-(6-phenyl-3-pyridinyl)fluoren-9-yl]hexyl-diethyl-hydroxyazanium |
|---|---|
| PubChem CID | 123348244 |
| Molecular Formula | C50H65N3O2+2 |
| Molecular Weight | 740.09 g/mol |
| Exact Mass | 739.51 |
| IUPAC Name | 6-[9-[6-[diethyl(hydroxy)azaniumyl]hexyl]-2-phenyl-7-(6-phenyl-3-pyridinyl)fluoren-9-yl]hexyl-diethyl-hydroxyazanium |
| SMILES | CC[N+](O)(CC)CCCCCCC1(CCCCCC[N+](O)(CC)CC)c2cc(-c3ccccc3)ccc2-c2ccc(-c3ccc(-c4ccccc4)nc3)cc21 |
| InChI | InChI=1S/C50H65N3O2/c1-5-52(54,6-2)35-21-11-9-19-33-50(34-20-10-12-22-36-53(55,7-3)8-4)47-37-42(40-23-15-13-16-24-40)27-30-45(47)46-31-28-43(38-48(46)50)44-29-32-49(51-39-44)41-25-17-14-18-26-41/h13-18,23-32,37-39,54-55H,5-12,19-22,33-36H2,1-4H3/q+2 |
| InChIKey | FZDOOHIXZPWHPS-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.09 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|