C55H94N4O2+4 — CID 102469998
6-[2-[2,5-bis[6-(trimethylazaniumyl)hexoxy]phenyl]-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium (PubChem CID 102469998) has the molecular formula C55H94N4O2+4 and a molecular weight of 843.38 g/mol. Its IUPAC name is 6-[2-[2,5-bis[6-(trimethylazaniumyl)hexoxy]phenyl]-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium.
| Compound Name | 6-[2-[2,5-bis[6-(trimethylazaniumyl)hexoxy]phenyl]-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium |
|---|---|
| PubChem CID | 102469998 |
| Molecular Formula | C55H94N4O2+4 |
| Molecular Weight | 843.38 g/mol |
| Exact Mass | 842.74 |
| IUPAC Name | 6-[2-[2,5-bis[6-(trimethylazaniumyl)hexoxy]phenyl]-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCCCCOc1ccc(OCCCCCC[N+](C)(C)C)c(-c2ccc3c(c2)C(CCCCCC[N+](C)(C)C)(CCCCCC[N+](C)(C)C)c2ccccc2-3)c1 |
| InChI | InChI=1S/C55H94N4O2/c1-56(2,3)39-25-15-13-23-37-55(38-24-14-16-26-40-57(4,5)6)52-32-22-21-31-49(52)50-35-33-47(45-53(50)55)51-46-48(60-43-29-19-17-27-41-58(7,8)9)34-36-54(51)61-44-30-20-18-28-42-59(10,11)12/h21-22,31-36,45-46H,13-20,23-30,37-44H2,1-12H3/q+4 |
| InChIKey | PWBYSCCLSMSIEU-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.38 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|