C33H55I2N2+ — CID 158580747
6-[2,7-dimethyl-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium;iodide;hydroiodide (PubChem CID 158580747) has the molecular formula C33H55I2N2+ and a molecular weight of 733.62 g/mol. Its IUPAC name is 6-[2,7-dimethyl-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium;iodide;hydroiodide.
| Compound Name | 6-[2,7-dimethyl-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium;iodide;hydroiodide |
|---|---|
| PubChem CID | 158580747 |
| Molecular Formula | C33H55I2N2+ |
| Molecular Weight | 733.62 g/mol |
| Exact Mass | 733.24 |
| IUPAC Name | 6-[2,7-dimethyl-9-[6-(trimethylazaniumyl)hexyl]fluoren-9-yl]hexyl-trimethylazanium;iodide;hydroiodide |
| SMILES | Cc1ccc2c(c1)C(CCCCCC[N+](C)(C)C)(CCCCCC[N+](C)(C)C)c1cc(C)ccc1-2.I.[I-] |
| InChI | InChI=1S/C33H54N2.2HI/c1-27-17-19-29-30-20-18-28(2)26-32(30)33(31(29)25-27,21-13-9-11-15-23-34(3,4)5)22-14-10-12-16-24-35(6,7)8;;/h17-20,25-26H,9-16,21-24H2,1-8H3;2*1H/q+2;;/p-1 |
| InChIKey | KGLRYOPMZWWAEL-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|