C29H44N2 — CID 118000276
5-[9-[5-(dimethylamino)pentyl]-2,7-dimethylfluoren-9-yl]-N,N-dimethylpentan-1-amine (PubChem CID 118000276) has the molecular formula C29H44N2 and a molecular weight of 420.69 g/mol. Its IUPAC name is 5-[9-[5-(dimethylamino)pentyl]-2,7-dimethylfluoren-9-yl]-N,N-dimethylpentan-1-amine.
| Compound Name | 5-[9-[5-(dimethylamino)pentyl]-2,7-dimethylfluoren-9-yl]-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 118000276 |
| Molecular Formula | C29H44N2 |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | 5-[9-[5-(dimethylamino)pentyl]-2,7-dimethylfluoren-9-yl]-N,N-dimethylpentan-1-amine |
| SMILES | Cc1ccc2c(c1)C(CCCCCN(C)C)(CCCCCN(C)C)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C29H44N2/c1-23-13-15-25-26-16-14-24(2)22-28(26)29(27(25)21-23,17-9-7-11-19-30(3)4)18-10-8-12-20-31(5)6/h13-16,21-22H,7-12,17-20H2,1-6H3 |
| InChIKey | BOSHYOPARNZJBY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|