C47H82N4O2 — CID 134387222
2-[6-[9-[6-[bis[3-(dimethylamino)propyl]amino]hexyl]-2,7-ditert-butylfluoren-9-yl]hexyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 134387222) has the molecular formula C47H82N4O2 and a molecular weight of 735.20 g/mol. Its IUPAC name is 2-[6-[9-[6-[bis[3-(dimethylamino)propyl]amino]hexyl]-2,7-ditert-butylfluoren-9-yl]hexyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[6-[9-[6-[bis[3-(dimethylamino)propyl]amino]hexyl]-2,7-ditert-butylfluoren-9-yl]hexyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 134387222 |
| Molecular Formula | C47H82N4O2 |
| Molecular Weight | 735.20 g/mol |
| Exact Mass | 734.64 |
| IUPAC Name | 2-[6-[9-[6-[bis[3-(dimethylamino)propyl]amino]hexyl]-2,7-ditert-butylfluoren-9-yl]hexyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | CN(C)CCCN(CCCCCCC1(CCCCCCN(CCO)CCO)c2cc(C(C)(C)C)ccc2-c2ccc(C(C)(C)C)cc21)CCCN(C)C |
| InChI | InChI=1S/C47H82N4O2/c1-45(2,3)39-21-23-41-42-24-22-40(46(4,5)6)38-44(42)47(43(41)37-39,26-16-12-14-18-30-51(33-35-52)34-36-53)25-15-11-13-17-29-50(31-19-27-48(7)8)32-20-28-49(9)10/h21-24,37-38,52-53H,11-20,25-36H2,1-10H3 |
| InChIKey | ZLUSGUKABXHPJU-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 53.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.20 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|