C45H57Br2N — CID 135170285
N,N-bis(4-bromophenyl)-2,7-ditert-butyl-9,9-dihexylfluoren-4-amine (PubChem CID 135170285) has the molecular formula C45H57Br2N and a molecular weight of 771.77 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-2,7-ditert-butyl-9,9-dihexylfluoren-4-amine.
| Compound Name | N,N-bis(4-bromophenyl)-2,7-ditert-butyl-9,9-dihexylfluoren-4-amine |
|---|---|
| PubChem CID | 135170285 |
| Molecular Formula | C45H57Br2N |
| Molecular Weight | 771.77 g/mol |
| Exact Mass | 769.29 |
| IUPAC Name | N,N-bis(4-bromophenyl)-2,7-ditert-butyl-9,9-dihexylfluoren-4-amine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(C(C)(C)C)ccc2-c2c(N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C45H57Br2N/c1-9-11-13-15-27-45(28-16-14-12-10-2)39-29-32(43(3,4)5)17-26-38(39)42-40(45)30-33(44(6,7)8)31-41(42)48(36-22-18-34(46)19-23-36)37-24-20-35(47)21-25-37/h17-26,29-31H,9-16,27-28H2,1-8H3 |
| InChIKey | DJEFJUCGPSTUSE-UHFFFAOYSA-N |
| XLogP | 15.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.77 |
| LogP ≤ 5 | 15.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|