C49H48Br4N2 — CID 134849382
2-N,2-N,7-N,7-N-tetrakis(4-bromophenyl)-9,9-dihexylfluorene-2,7-diamine (PubChem CID 134849382) has the molecular formula C49H48Br4N2 and a molecular weight of 984.55 g/mol. Its IUPAC name is 2-N,2-N,7-N,7-N-tetrakis(4-bromophenyl)-9,9-dihexylfluorene-2,7-diamine.
| Compound Name | 2-N,2-N,7-N,7-N-tetrakis(4-bromophenyl)-9,9-dihexylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 134849382 |
| Molecular Formula | C49H48Br4N2 |
| Molecular Weight | 984.55 g/mol |
| Exact Mass | 980.06 |
| IUPAC Name | 2-N,2-N,7-N,7-N-tetrakis(4-bromophenyl)-9,9-dihexylfluorene-2,7-diamine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)ccc2-c2ccc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C49H48Br4N2/c1-3-5-7-9-31-49(32-10-8-6-4-2)47-33-43(54(39-19-11-35(50)12-20-39)40-21-13-36(51)14-22-40)27-29-45(47)46-30-28-44(34-48(46)49)55(41-23-15-37(52)16-24-41)42-25-17-38(53)18-26-42/h11-30,33-34H,3-10,31-32H2,1-2H3 |
| InChIKey | FPSGJMUCCHUNRR-UHFFFAOYSA-N |
| XLogP | 17.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.55 |
| LogP ≤ 5 | 17.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|