C48H48BrIN2 — CID 142315300
2-N-(4-bromophenyl)-9-iodo-2-N,7-N,7-N-tris(4-methylphenyl)-9-octylfluorene-2,7-diamine (PubChem CID 142315300) has the molecular formula C48H48BrIN2 and a molecular weight of 859.73 g/mol. Its IUPAC name is 2-N-(4-bromophenyl)-9-iodo-2-N,7-N,7-N-tris(4-methylphenyl)-9-octylfluorene-2,7-diamine.
| Compound Name | 2-N-(4-bromophenyl)-9-iodo-2-N,7-N,7-N-tris(4-methylphenyl)-9-octylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 142315300 |
| Molecular Formula | C48H48BrIN2 |
| Molecular Weight | 859.73 g/mol |
| Exact Mass | 858.20 |
| IUPAC Name | 2-N-(4-bromophenyl)-9-iodo-2-N,7-N,7-N-tris(4-methylphenyl)-9-octylfluorene-2,7-diamine |
| SMILES | CCCCCCCCC1(I)c2cc(N(c3ccc(C)cc3)c3ccc(C)cc3)ccc2-c2ccc(N(c3ccc(C)cc3)c3ccc(Br)cc3)cc21 |
| InChI | InChI=1S/C48H48BrIN2/c1-5-6-7-8-9-10-31-48(50)46-32-42(51(38-19-11-34(2)12-20-38)39-21-13-35(3)14-22-39)27-29-44(46)45-30-28-43(33-47(45)48)52(40-23-15-36(4)16-24-40)41-25-17-37(49)18-26-41/h11-30,32-33H,5-10,31H2,1-4H3 |
| InChIKey | ZYDIYDBLNBMNAF-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.73 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|