C21H23Br2I — CID 138531843
2,7-dibromo-9-iodo-9-octylfluorene (PubChem CID 138531843) has the molecular formula C21H23Br2I and a molecular weight of 562.13 g/mol. Its IUPAC name is 2,7-dibromo-9-iodo-9-octylfluorene.
| Compound Name | 2,7-dibromo-9-iodo-9-octylfluorene |
|---|---|
| PubChem CID | 138531843 |
| Molecular Formula | C21H23Br2I |
| Molecular Weight | 562.13 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | 2,7-dibromo-9-iodo-9-octylfluorene |
| SMILES | CCCCCCCCC1(I)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C21H23Br2I/c1-2-3-4-5-6-7-12-21(24)19-13-15(22)8-10-17(19)18-11-9-16(23)14-20(18)21/h8-11,13-14H,2-7,12H2,1H3 |
| InChIKey | IFOAGAUAHNFMIR-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.13 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|