C22H27Br2N — CID 146448745
3-(2,7-dibromo-9-hexylfluoren-9-yl)propan-1-amine (PubChem CID 146448745) has the molecular formula C22H27Br2N and a molecular weight of 465.27 g/mol. Its IUPAC name is 3-(2,7-dibromo-9-hexylfluoren-9-yl)propan-1-amine.
| Compound Name | 3-(2,7-dibromo-9-hexylfluoren-9-yl)propan-1-amine |
|---|---|
| PubChem CID | 146448745 |
| Molecular Formula | C22H27Br2N |
| Molecular Weight | 465.27 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 3-(2,7-dibromo-9-hexylfluoren-9-yl)propan-1-amine |
| SMILES | CCCCCCC1(CCCN)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C22H27Br2N/c1-2-3-4-5-11-22(12-6-13-25)20-14-16(23)7-9-18(20)19-10-8-17(24)15-21(19)22/h7-10,14-15H,2-6,11-13,25H2,1H3 |
| InChIKey | FGAMDHWWTAAFRC-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.27 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|